C15H31N3 — CID 142067876
4-N-[3-[[(Z)-4-methylpent-2-en-3-yl]amino]propyl]cyclohexane-1,4-diamine (PubChem CID 142067876) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-N-[3-[[(Z)-4-methylpent-2-en-3-yl]amino]propyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[3-[[(Z)-4-methylpent-2-en-3-yl]amino]propyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 142067876 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 4-N-[3-[[(Z)-4-methylpent-2-en-3-yl]amino]propyl]cyclohexane-1,4-diamine |
| SMILES | C/C=C(\NCCCNC1CCC(N)CC1)C(C)C |
| InChI | InChI=1S/C15H31N3/c1-4-15(12(2)3)18-11-5-10-17-14-8-6-13(16)7-9-14/h4,12-14,17-18H,5-11,16H2,1-3H3/b15-4- |
| InChIKey | MKIGQICJMYZKOC-TVPGTPATSA-N |
| XLogP | 2.39 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|