C12H26N2 — CID 165455015
N-cyclopropyl-N',N'-di(propan-2-yl)propane-1,3-diamine (PubChem CID 165455015) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N-cyclopropyl-N',N'-di(propan-2-yl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N',N'-di(propan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 165455015 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N-cyclopropyl-N',N'-di(propan-2-yl)propane-1,3-diamine |
| SMILES | CC(C)N(CCCNC1CC1)C(C)C |
| InChI | InChI=1S/C12H26N2/c1-10(2)14(11(3)4)9-5-8-13-12-6-7-12/h10-13H,5-9H2,1-4H3 |
| InChIKey | WAJVXVBIVWUXCG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|