About N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine
N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine (PubChem CID 60868035) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine |
| PubChem CID | 60868035 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CN(C)CCCNC1CC1 |
| InChI | InChI=1S/C11H24N2/c1-10(2)9-13(3)8-4-7-12-11-5-6-11/h10-12H,4-9H2,1-3H3 |
| InChIKey | HXUCIEWKWRMDLM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine?
The IUPAC name of N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine (CID 60868035) is N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine.
What is the SMILES notation for N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine?
The canonical SMILES for N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine is CC(C)CN(C)CCCNC1CC1.
What is the InChIKey of N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine?
The InChIKey is HXUCIEWKWRMDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-10(2)9-13(3)8-4-7-12-11-5-6-11/h10-12H,4-9H2,1-3H3.
What are the key properties of N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine?
N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine has a molecular weight of 184.33 g/mol, XLogP of 1.72, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine is sourced from PubChem (CID 60868035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).