C11H24Cl2N2 — CID 86277360
4-N-cyclopentylcyclohexane-1,4-diamine;dihydrochloride (PubChem CID 86277360) has the molecular formula C11H24Cl2N2 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-N-cyclopentylcyclohexane-1,4-diamine;dihydrochloride.
| Compound Name | 4-N-cyclopentylcyclohexane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 86277360 |
| Molecular Formula | C11H24Cl2N2 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-N-cyclopentylcyclohexane-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC2CCCC2)CC1 |
| InChI | InChI=1S/C11H22N2.2ClH/c12-9-5-7-11(8-6-9)13-10-3-1-2-4-10;;/h9-11,13H,1-8,12H2;2*1H |
| InChIKey | UZPMBNLEWKJACX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |