C10H20N2 — CID 80559420
1-N-cyclohexylcyclobutane-1,3-diamine (PubChem CID 80559420) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-N-cyclohexylcyclobutane-1,3-diamine.
| Compound Name | 1-N-cyclohexylcyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80559420 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-N-cyclohexylcyclobutane-1,3-diamine |
| SMILES | NC1CC(NC2CCCCC2)C1 |
| InChI | InChI=1S/C10H20N2/c11-8-6-10(7-8)12-9-4-2-1-3-5-9/h8-10,12H,1-7,11H2 |
| InChIKey | FVRUFHCGGVVWKP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |