C9H15N3S2 — CID 107647994
5-ethyl-N-(thian-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107647994) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 5-ethyl-N-(thian-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-ethyl-N-(thian-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107647994 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5-ethyl-N-(thian-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCc1nnc(NC2CCSCC2)s1 |
| InChI | InChI=1S/C9H15N3S2/c1-2-8-11-12-9(14-8)10-7-3-5-13-6-4-7/h7H,2-6H2,1H3,(H,10,12) |
| InChIKey | KFJMJTJYGYISKR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |