C20H27N3OS — CID 91368430
7-(aminomethyl)-N-cyclohexyl-12-methoxy-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-amine (PubChem CID 91368430) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 7-(aminomethyl)-N-cyclohexyl-12-methoxy-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-amine.
| Compound Name | 7-(aminomethyl)-N-cyclohexyl-12-methoxy-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-amine |
|---|---|
| PubChem CID | 91368430 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 7-(aminomethyl)-N-cyclohexyl-12-methoxy-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-amine |
| SMILES | COc1ccc2c(c1)CCC(CN)c1sc(NC3CCCCC3)nc1-2 |
| InChI | InChI=1S/C20H27N3OS/c1-24-16-9-10-17-13(11-16)7-8-14(12-21)19-18(17)23-20(25-19)22-15-5-3-2-4-6-15/h9-11,14-15H,2-8,12,21H2,1H3,(H,22,23) |
| InChIKey | MHCBRQDMZOJSNS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |