C12H12CoN2OS+2 — CID 71595556
cobalt(2+);7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine (PubChem CID 71595556) has the molecular formula C12H12CoN2OS+2 and a molecular weight of 291.24 g/mol. Its IUPAC name is cobalt(2+);7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine.
| Compound Name | cobalt(2+);7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 71595556 |
| Molecular Formula | C12H12CoN2OS+2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | cobalt(2+);7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
| SMILES | COc1ccc2c(c1)CCc1sc(N)nc1-2.[Co+2] |
| InChI | InChI=1S/C12H12N2OS.Co/c1-15-8-3-4-9-7(6-8)2-5-10-11(9)14-12(13)16-10;/h3-4,6H,2,5H2,1H3,(H2,13,14);/q;+2 |
| InChIKey | IVTFGNYLENTVSW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |