C19H15ClN2O2S — CID 4103019
4-chloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)benzamide (PubChem CID 4103019) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 4-chloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)benzamide.
| Compound Name | 4-chloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4103019 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-chloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2c(c1)CCc1sc(NC(=O)c3ccc(Cl)cc3)nc1-2 |
| InChI | InChI=1S/C19H15ClN2O2S/c1-24-14-7-8-15-12(10-14)4-9-16-17(15)21-19(25-16)22-18(23)11-2-5-13(20)6-3-11/h2-3,5-8,10H,4,9H2,1H3,(H,21,22,23) |
| InChIKey | OKEIEIXYDQDGRA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |