C19H14ClN3O4S — CID 126065626
2-chloro-N-(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-4-nitrobenzamide (PubChem CID 126065626) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is 2-chloro-N-(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 126065626 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-chloro-N-(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-4-nitrobenzamide |
| SMILES | COc1ccc2c(c1)-c1nc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)sc1CC2 |
| InChI | InChI=1S/C19H14ClN3O4S/c1-27-12-5-2-10-3-7-16-17(14(10)9-12)21-19(28-16)22-18(24)13-6-4-11(23(25)26)8-15(13)20/h2,4-6,8-9H,3,7H2,1H3,(H,21,22,24) |
| InChIKey | VOYBUFIKYOXPRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|