C14H12BrN3O3S — CID 10452467
2-bromo-N-(13-nitro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)acetamide (PubChem CID 10452467) has the molecular formula C14H12BrN3O3S and a molecular weight of 382.24 g/mol. Its IUPAC name is 2-bromo-N-(13-nitro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)acetamide.
| Compound Name | 2-bromo-N-(13-nitro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)acetamide |
|---|---|
| PubChem CID | 10452467 |
| Molecular Formula | C14H12BrN3O3S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 2-bromo-N-(13-nitro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)acetamide |
| SMILES | O=C(CBr)Nc1nc2c(s1)CCCc1ccc([N+](=O)[O-])cc1-2 |
| InChI | InChI=1S/C14H12BrN3O3S/c15-7-12(19)16-14-17-13-10-6-9(18(20)21)5-4-8(10)2-1-3-11(13)22-14/h4-6H,1-3,7H2,(H,16,17,19) |
| InChIKey | DAKAIPXEKUFMJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|