C16H12ClN5O4 — CID 9246363
2-chloro-N-[5-(4-methoxyphenyl)-1H-1,2,4-triazol-3-yl]-4-nitrobenzamide (PubChem CID 9246363) has the molecular formula C16H12ClN5O4 and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-chloro-N-[5-(4-methoxyphenyl)-1H-1,2,4-triazol-3-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[5-(4-methoxyphenyl)-1H-1,2,4-triazol-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9246363 |
| Molecular Formula | C16H12ClN5O4 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-chloro-N-[5-(4-methoxyphenyl)-1H-1,2,4-triazol-3-yl]-4-nitrobenzamide |
| SMILES | COc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C16H12ClN5O4/c1-26-11-5-2-9(3-6-11)14-18-16(21-20-14)19-15(23)12-7-4-10(22(24)25)8-13(12)17/h2-8H,1H3,(H2,18,19,20,21,23) |
| InChIKey | KESZBSZATGPSPL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|