C22H30N2O2S — CID 2727896
N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)decanamide (PubChem CID 2727896) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)decanamide.
| Compound Name | N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)decanamide |
|---|---|
| PubChem CID | 2727896 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1nc2c(s1)CCc1cc(OC)ccc1-2 |
| InChI | InChI=1S/C22H30N2O2S/c1-3-4-5-6-7-8-9-10-20(25)23-22-24-21-18-13-12-17(26-2)15-16(18)11-14-19(21)27-22/h12-13,15H,3-11,14H2,1-2H3,(H,23,24,25) |
| InChIKey | GFEWYNPHEBNPLX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|