About 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea
1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea (PubChem CID 67854777) has the molecular formula C24H29N3O3S
and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea |
| PubChem CID | 67854777 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(-c2nc(C(C)(C)NC(=O)NC(C)C)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-15(2)25-23(28)27-24(3,4)22-26-20(16-7-11-18(29-5)12-8-16)21(31-22)17-9-13-19(30-6)14-10-17/h7-15H,1-6H3,(H2,25,27,28) |
| InChIKey | PMPGBNBORPDMOY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea?
The IUPAC name of 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea (CID 67854777) is 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea.
What is the SMILES notation for 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea?
The canonical SMILES for 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea is COc1ccc(-c2nc(C(C)(C)NC(=O)NC(C)C)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea?
The InChIKey is PMPGBNBORPDMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O3S/c1-15(2)25-23(28)27-24(3,4)22-26-20(16-7-11-18(29-5)12-8-16)21(31-22)17-9-13-19(30-6)14-10-17/h7-15H,1-6H3,(H2,25,27,28).
What are the key properties of 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea?
1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea has a molecular weight of 439.58 g/mol, XLogP of 5.44, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-yl]-3-propan-2-ylurea is sourced from PubChem (CID 67854777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).