C22H25N5O3 — CID 10319226
1-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-3-propan-2-ylurea (PubChem CID 10319226) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 10319226 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-3-propan-2-ylurea |
| SMILES | COc1ccc(-c2nnc(CNC(=O)NC(C)C)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-14(2)24-22(28)23-13-19-25-20(15-5-9-17(29-3)10-6-15)21(27-26-19)16-7-11-18(30-4)12-8-16/h5-12,14H,13H2,1-4H3,(H2,23,24,28) |
| InChIKey | UGBIVRZGEUUFBV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |