C18H23N3O2 — CID 95096708
1-[(2R)-butan-2-yl]-3-[[2-(4-methoxyphenyl)-3-pyridinyl]methyl]urea (PubChem CID 95096708) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-[[2-(4-methoxyphenyl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-[[2-(4-methoxyphenyl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 95096708 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-[[2-(4-methoxyphenyl)-3-pyridinyl]methyl]urea |
| SMILES | CC[C@@H](C)NC(=O)NCc1cccnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H23N3O2/c1-4-13(2)21-18(22)20-12-15-6-5-11-19-17(15)14-7-9-16(23-3)10-8-14/h5-11,13H,4,12H2,1-3H3,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | KATNVJZIWILWDC-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |