C27H26N2O4S — CID 126213988
(4S)-N-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-hydroxy-4-phenylbutanamide (PubChem CID 126213988) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is (4S)-N-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-hydroxy-4-phenylbutanamide.
| Compound Name | (4S)-N-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 126213988 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (4S)-N-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-hydroxy-4-phenylbutanamide |
| SMILES | COc1ccc(-c2nc(NC(=O)CC[C@H](O)c3ccccc3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O4S/c1-32-21-12-8-19(9-13-21)25-26(20-10-14-22(33-2)15-11-20)34-27(29-25)28-24(31)17-16-23(30)18-6-4-3-5-7-18/h3-15,23,30H,16-17H2,1-2H3,(H,28,29,31)/t23-/m0/s1 |
| InChIKey | ZSTWTHJQQRNDTO-QHCPKHFHSA-N |
| XLogP | 5.95 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |