C21H18N2O2S2 — CID 3819108
4-hydroxy-5-[5-(4-methoxyphenyl)iminopenta-1,3-dienyl]-3-phenyl-1,3-thiazole-2-thione (PubChem CID 3819108) has the molecular formula C21H18N2O2S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-hydroxy-5-[5-(4-methoxyphenyl)iminopenta-1,3-dienyl]-3-phenyl-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[5-(4-methoxyphenyl)iminopenta-1,3-dienyl]-3-phenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 3819108 |
| Molecular Formula | C21H18N2O2S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-hydroxy-5-[5-(4-methoxyphenyl)iminopenta-1,3-dienyl]-3-phenyl-1,3-thiazole-2-thione |
| SMILES | COc1ccc(/N=C/C=CC=Cc2sc(=S)n(-c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C21H18N2O2S2/c1-25-18-13-11-16(12-14-18)22-15-7-3-6-10-19-20(24)23(21(26)27-19)17-8-4-2-5-9-17/h2-15,24H,1H3/b7-3?,10-6?,22-15+ |
| InChIKey | IVFDNMJUQPLCJC-HAEXYWPRSA-N |
| XLogP | 5.95 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|