C21H16N2O4S2 — CID 136663131
(3Z)-3-[[4-hydroxy-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one (PubChem CID 136663131) has the molecular formula C21H16N2O4S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3Z)-3-[[4-hydroxy-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one.
| Compound Name | (3Z)-3-[[4-hydroxy-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 136663131 |
| Molecular Formula | C21H16N2O4S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (3Z)-3-[[4-hydroxy-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one |
| SMILES | COc1cccc(-n2c(O)c(/C=C3/C=c4ccc(OC)cc4=NC3=O)sc2=S)c1 |
| InChI | InChI=1S/C21H16N2O4S2/c1-26-15-5-3-4-14(10-15)23-20(25)18(29-21(23)28)9-13-8-12-6-7-16(27-2)11-17(12)22-19(13)24/h3-11,25H,1-2H3/b13-9- |
| InChIKey | IQLWGWGCZDAJDD-LCYFTJDESA-N |
| XLogP | 3.01 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|