C20H11ClN2O4S2 — CID 135653169
(7E)-7-[[3-(3-chlorophenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 135653169) has the molecular formula C20H11ClN2O4S2 and a molecular weight of 442.91 g/mol. Its IUPAC name is (7E)-7-[[3-(3-chlorophenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | (7E)-7-[[3-(3-chlorophenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 135653169 |
| Molecular Formula | C20H11ClN2O4S2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | (7E)-7-[[3-(3-chlorophenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=C1N=c2cc3c(cc2=C/C1=C\c1sc(=S)n(-c2cccc(Cl)c2)c1O)OCO3 |
| InChI | InChI=1S/C20H11ClN2O4S2/c21-12-2-1-3-13(7-12)23-19(25)17(29-20(23)28)6-11-4-10-5-15-16(27-9-26-15)8-14(10)22-18(11)24/h1-8,25H,9H2/b11-6+ |
| InChIKey | UQUJPUIVXVHVGW-IZZDOVSWSA-N |
| XLogP | 3.38 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|