C21H18N2OS2 — CID 1328812
5-[(2,5-dimethylindol-3-ylidene)methyl]-4-hydroxy-3-(3-methylphenyl)-1,3-thiazole-2-thione (PubChem CID 1328812) has the molecular formula C21H18N2OS2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 5-[(2,5-dimethylindol-3-ylidene)methyl]-4-hydroxy-3-(3-methylphenyl)-1,3-thiazole-2-thione.
| Compound Name | 5-[(2,5-dimethylindol-3-ylidene)methyl]-4-hydroxy-3-(3-methylphenyl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 1328812 |
| Molecular Formula | C21H18N2OS2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-[(2,5-dimethylindol-3-ylidene)methyl]-4-hydroxy-3-(3-methylphenyl)-1,3-thiazole-2-thione |
| SMILES | CC1=Nc2ccc(C)cc2C1=Cc1sc(=S)n(-c2cccc(C)c2)c1O |
| InChI | InChI=1S/C21H18N2OS2/c1-12-5-4-6-15(9-12)23-20(24)19(26-21(23)25)11-16-14(3)22-18-8-7-13(2)10-17(16)18/h4-11,24H,1-3H3 |
| InChIKey | BQNVQMZBPXCCPS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|