C19H13BrN2OS2 — CID 135659420
3-(3-bromophenyl)-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione (PubChem CID 135659420) has the molecular formula C19H13BrN2OS2 and a molecular weight of 429.36 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione.
| Compound Name | 3-(3-bromophenyl)-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135659420 |
| Molecular Formula | C19H13BrN2OS2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 3-(3-bromophenyl)-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
| SMILES | CC1=Nc2ccccc2/C1=C/c1sc(=S)n(-c2cccc(Br)c2)c1O |
| InChI | InChI=1S/C19H13BrN2OS2/c1-11-15(14-7-2-3-8-16(14)21-11)10-17-18(23)22(19(24)25-17)13-6-4-5-12(20)9-13/h2-10,23H,1H3/b15-10+ |
| InChIKey | WVVNABWRWJELFR-XNTDXEJSSA-N |
| XLogP | 6.38 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|