C19H12BrClN2OS2 — CID 137068697
3-(4-bromo-3-chlorophenyl)-4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione (PubChem CID 137068697) has the molecular formula C19H12BrClN2OS2 and a molecular weight of 463.81 g/mol. Its IUPAC name is 3-(4-bromo-3-chlorophenyl)-4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione.
| Compound Name | 3-(4-bromo-3-chlorophenyl)-4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137068697 |
| Molecular Formula | C19H12BrClN2OS2 |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | 3-(4-bromo-3-chlorophenyl)-4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
| SMILES | CC1=Nc2ccccc2C1=Cc1sc(=S)n(-c2ccc(Br)c(Cl)c2)c1O |
| InChI | InChI=1S/C19H12BrClN2OS2/c1-10-13(12-4-2-3-5-16(12)22-10)9-17-18(24)23(19(25)26-17)11-6-7-14(20)15(21)8-11/h2-9,24H,1H3 |
| InChIKey | CSNQTRVNTVGNRP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|