C19H20N2OS2 — CID 135719271
3-cyclohexyl-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione (PubChem CID 135719271) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3-cyclohexyl-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione.
| Compound Name | 3-cyclohexyl-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135719271 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-cyclohexyl-4-hydroxy-5-[(Z)-(2-methylindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
| SMILES | CC1=Nc2ccccc2/C1=C/c1sc(=S)n(C2CCCCC2)c1O |
| InChI | InChI=1S/C19H20N2OS2/c1-12-15(14-9-5-6-10-16(14)20-12)11-17-18(22)21(19(23)24-17)13-7-3-2-4-8-13/h5-6,9-11,13,22H,2-4,7-8H2,1H3/b15-11+ |
| InChIKey | GRWYQHNTKKSEFI-RVDMUPIBSA-N |
| XLogP | 6.14 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|