C17H13N3O5S2 — CID 135904172
N-[4-hydroxy-5-[(7-oxo-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetamide (PubChem CID 135904172) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[4-hydroxy-5-[(7-oxo-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetamide.
| Compound Name | N-[4-hydroxy-5-[(7-oxo-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 135904172 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-[4-hydroxy-5-[(7-oxo-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
| SMILES | CC(=O)Nn1c(O)c(C=C2C=c3cc4c(cc3=NC2=O)OCCO4)sc1=S |
| InChI | InChI=1S/C17H13N3O5S2/c1-8(21)19-20-16(23)14(27-17(20)26)6-10-4-9-5-12-13(25-3-2-24-12)7-11(9)18-15(10)22/h4-7,23H,2-3H2,1H3,(H,19,21) |
| InChIKey | ZOWIFKVPAMZVDO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|