C22H18F2N2O4S2 — CID 135440421
6-[5-[(Z)-[(5E)-5-(5,6-difluoroindol-2-ylidene)furan-2-ylidene]methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid (PubChem CID 135440421) has the molecular formula C22H18F2N2O4S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 6-[5-[(Z)-[(5E)-5-(5,6-difluoroindol-2-ylidene)furan-2-ylidene]methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid.
| Compound Name | 6-[5-[(Z)-[(5E)-5-(5,6-difluoroindol-2-ylidene)furan-2-ylidene]methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 135440421 |
| Molecular Formula | C22H18F2N2O4S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 6-[5-[(Z)-[(5E)-5-(5,6-difluoroindol-2-ylidene)furan-2-ylidene]methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCn1c(O)c(/C=c2/cc/c(=C3/C=c4cc(F)c(F)cc4=N3)o2)sc1=S |
| InChI | InChI=1S/C22H18F2N2O4S2/c23-14-8-12-9-17(25-16(12)11-15(14)24)18-6-5-13(30-18)10-19-21(29)26(22(31)32-19)7-3-1-2-4-20(27)28/h5-6,8-11,29H,1-4,7H2,(H,27,28)/b13-10-,18-17+ |
| InChIKey | LTUVZLATGIPVNC-UXAVLHGKSA-N |
| XLogP | 2.55 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|