C22H20N2O4S2 — CID 135412937
6-[4-hydroxy-5-[(E)-[(5Z)-5-indol-5-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid (PubChem CID 135412937) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 6-[4-hydroxy-5-[(E)-[(5Z)-5-indol-5-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid.
| Compound Name | 6-[4-hydroxy-5-[(E)-[(5Z)-5-indol-5-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 135412937 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 6-[4-hydroxy-5-[(E)-[(5Z)-5-indol-5-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCn1c(O)c(/C=c2\cc/c(=c3\ccc4c(c3)C=CN=4)o2)sc1=S |
| InChI | InChI=1S/C22H20N2O4S2/c25-20(26)4-2-1-3-11-24-21(27)19(30-22(24)29)13-16-6-8-18(28-16)15-5-7-17-14(12-15)9-10-23-17/h5-10,12-13,27H,1-4,11H2,(H,25,26)/b16-13+,18-15- |
| InChIKey | UTPUOMJBCQTLTP-GPJXYEHOSA-N |
| XLogP | 3.94 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|