C23H19F3N2O4S2 — CID 135536834
6-[4-hydroxy-2-sulfanylidene-5-[(E)-[(5E)-5-[6-(trifluoromethyl)indol-5-ylidene]furan-2-ylidene]methyl]-1,3-thiazol-3-yl]hexanoic acid (PubChem CID 135536834) has the molecular formula C23H19F3N2O4S2 and a molecular weight of 508.54 g/mol. Its IUPAC name is 6-[4-hydroxy-2-sulfanylidene-5-[(E)-[(5E)-5-[6-(trifluoromethyl)indol-5-ylidene]furan-2-ylidene]methyl]-1,3-thiazol-3-yl]hexanoic acid.
| Compound Name | 6-[4-hydroxy-2-sulfanylidene-5-[(E)-[(5E)-5-[6-(trifluoromethyl)indol-5-ylidene]furan-2-ylidene]methyl]-1,3-thiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 135536834 |
| Molecular Formula | C23H19F3N2O4S2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 6-[4-hydroxy-2-sulfanylidene-5-[(E)-[(5E)-5-[6-(trifluoromethyl)indol-5-ylidene]furan-2-ylidene]methyl]-1,3-thiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCn1c(O)c(/C=c2\cc/c(=c3/cc4c(cc3C(F)(F)F)=NC=C4)o2)sc1=S |
| InChI | InChI=1S/C23H19F3N2O4S2/c24-23(25,26)16-12-17-13(7-8-27-17)10-15(16)18-6-5-14(32-18)11-19-21(31)28(22(33)34-19)9-3-1-2-4-20(29)30/h5-8,10-12,31H,1-4,9H2,(H,29,30)/b14-11+,18-15+ |
| InChIKey | RESJQWRILMOYJE-IJANBFSMSA-N |
| XLogP | 4.96 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|