C23H14N2O4S2 — CID 135765181
4-[4-hydroxy-5-[(E)-[(5E)-5-indol-2-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid (PubChem CID 135765181) has the molecular formula C23H14N2O4S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-[4-hydroxy-5-[(E)-[(5E)-5-indol-2-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid.
| Compound Name | 4-[4-hydroxy-5-[(E)-[(5E)-5-indol-2-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 135765181 |
| Molecular Formula | C23H14N2O4S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 4-[4-hydroxy-5-[(E)-[(5E)-5-indol-2-ylidenefuran-2-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2c(O)c(/C=c3\cc/c(=C4/C=c5ccccc5=N4)o3)sc2=S)cc1 |
| InChI | InChI=1S/C23H14N2O4S2/c26-21-20(31-23(30)25(21)15-7-5-13(6-8-15)22(27)28)12-16-9-10-19(29-16)18-11-14-3-1-2-4-17(14)24-18/h1-12,26H,(H,27,28)/b16-12+,19-18+ |
| InChIKey | FBMWBKDRPLYQJJ-IRYZSLSISA-N |
| XLogP | 2.32 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|