C15H12N2O3S2 — CID 135904093
3-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-7-methoxyquinolin-2-one (PubChem CID 135904093) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 3-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-7-methoxyquinolin-2-one.
| Compound Name | 3-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-7-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 135904093 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-7-methoxyquinolin-2-one |
| SMILES | COc1ccc2c(c1)=NC(=O)C(=Cc1sc(=S)n(C)c1O)C=2 |
| InChI | InChI=1S/C15H12N2O3S2/c1-17-14(19)12(22-15(17)21)6-9-5-8-3-4-10(20-2)7-11(8)16-13(9)18/h3-7,19H,1-2H3 |
| InChIKey | MPHHMMKGJUSGAP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|