C14H12N2O2S2 — CID 135778482
4-hydroxy-5-[(Z)-(6-methoxyindol-3-ylidene)methyl]-3-methyl-1,3-thiazole-2-thione (PubChem CID 135778482) has the molecular formula C14H12N2O2S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-hydroxy-5-[(Z)-(6-methoxyindol-3-ylidene)methyl]-3-methyl-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[(Z)-(6-methoxyindol-3-ylidene)methyl]-3-methyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135778482 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-hydroxy-5-[(Z)-(6-methoxyindol-3-ylidene)methyl]-3-methyl-1,3-thiazole-2-thione |
| SMILES | COc1ccc2c(c1)N=C/C2=C\c1sc(=S)n(C)c1O |
| InChI | InChI=1S/C14H12N2O2S2/c1-16-13(17)12(20-14(16)19)5-8-7-15-11-6-9(18-2)3-4-10(8)11/h3-7,17H,1-2H3/b8-5+ |
| InChIKey | GKZLZVHFTGGEKJ-VMPITWQZSA-N |
| XLogP | 3.79 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|