C20H15BrN2O2S2 — CID 137126764
5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[(4-methoxyphenyl)methyl]-1,3-thiazole-2-thione (PubChem CID 137126764) has the molecular formula C20H15BrN2O2S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[(4-methoxyphenyl)methyl]-1,3-thiazole-2-thione.
| Compound Name | 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[(4-methoxyphenyl)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137126764 |
| Molecular Formula | C20H15BrN2O2S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[(4-methoxyphenyl)methyl]-1,3-thiazole-2-thione |
| SMILES | COc1ccc(Cn2c(O)c(C=C3C=Nc4ccc(Br)cc43)sc2=S)cc1 |
| InChI | InChI=1S/C20H15BrN2O2S2/c1-25-15-5-2-12(3-6-15)11-23-19(24)18(27-20(23)26)8-13-10-22-17-7-4-14(21)9-16(13)17/h2-10,24H,11H2,1H3 |
| InChIKey | ZOKGARNJQVMNBO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|