C18H14BrN3OS2 — CID 137126657
5-[(5-bromoindol-3-ylidene)methyl]-3-(2,5-dimethylpyrrol-1-yl)-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 137126657) has the molecular formula C18H14BrN3OS2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 5-[(5-bromoindol-3-ylidene)methyl]-3-(2,5-dimethylpyrrol-1-yl)-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 5-[(5-bromoindol-3-ylidene)methyl]-3-(2,5-dimethylpyrrol-1-yl)-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137126657 |
| Molecular Formula | C18H14BrN3OS2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 5-[(5-bromoindol-3-ylidene)methyl]-3-(2,5-dimethylpyrrol-1-yl)-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | Cc1ccc(C)n1-n1c(O)c(C=C2C=Nc3ccc(Br)cc32)sc1=S |
| InChI | InChI=1S/C18H14BrN3OS2/c1-10-3-4-11(2)21(10)22-17(23)16(25-18(22)24)7-12-9-20-15-6-5-13(19)8-14(12)15/h3-9,23H,1-2H3 |
| InChIKey | SZMCQLFVDMORII-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|