C18H14N2O3S2 — CID 135652843
3-(furan-2-ylmethyl)-4-hydroxy-5-[(E)-(6-methoxyindol-3-ylidene)methyl]-1,3-thiazole-2-thione (PubChem CID 135652843) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-4-hydroxy-5-[(E)-(6-methoxyindol-3-ylidene)methyl]-1,3-thiazole-2-thione.
| Compound Name | 3-(furan-2-ylmethyl)-4-hydroxy-5-[(E)-(6-methoxyindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135652843 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-(furan-2-ylmethyl)-4-hydroxy-5-[(E)-(6-methoxyindol-3-ylidene)methyl]-1,3-thiazole-2-thione |
| SMILES | COc1ccc2c(c1)N=C/C2=C/c1sc(=S)n(Cc2ccco2)c1O |
| InChI | InChI=1S/C18H14N2O3S2/c1-22-12-4-5-14-11(9-19-15(14)8-12)7-16-17(21)20(18(24)25-16)10-13-3-2-6-23-13/h2-9,21H,10H2,1H3/b11-7- |
| InChIKey | JDRNRACXVMOQCY-XFFZJAGNSA-N |
| XLogP | 4.89 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|