C16H14N2O2S2 — CID 137249186
3-(furan-2-ylmethyl)-4-hydroxy-5-[(3-methylphenyl)iminomethyl]-1,3-thiazole-2-thione (PubChem CID 137249186) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-4-hydroxy-5-[(3-methylphenyl)iminomethyl]-1,3-thiazole-2-thione.
| Compound Name | 3-(furan-2-ylmethyl)-4-hydroxy-5-[(3-methylphenyl)iminomethyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137249186 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-(furan-2-ylmethyl)-4-hydroxy-5-[(3-methylphenyl)iminomethyl]-1,3-thiazole-2-thione |
| SMILES | Cc1cccc(/N=C/c2sc(=S)n(Cc3ccco3)c2O)c1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-11-4-2-5-12(8-11)17-9-14-15(19)18(16(21)22-14)10-13-6-3-7-20-13/h2-9,19H,10H2,1H3/b17-9+ |
| InChIKey | YLXBSFZMXHRPFX-RQZCQDPDSA-N |
| XLogP | 4.69 |
| TPSA | 50.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|