C13H12N4OS2 — CID 1325662
5-(1H-benzimidazol-2-yliminomethyl)-3-ethyl-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 1325662) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yliminomethyl)-3-ethyl-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 5-(1H-benzimidazol-2-yliminomethyl)-3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 1325662 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-(1H-benzimidazol-2-yliminomethyl)-3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | CCn1c(O)c(C=Nc2nc3ccccc3[nH]2)sc1=S |
| InChI | InChI=1S/C13H12N4OS2/c1-2-17-11(18)10(20-13(17)19)7-14-12-15-8-5-3-4-6-9(8)16-12/h3-7,18H,2H2,1H3,(H,15,16) |
| InChIKey | PALKEGCPIMFLDA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|