C20H14N2O4S2 — CID 136920037
3-[4-hydroxy-5-[(5-methoxyindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid (PubChem CID 136920037) has the molecular formula C20H14N2O4S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[4-hydroxy-5-[(5-methoxyindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid.
| Compound Name | 3-[4-hydroxy-5-[(5-methoxyindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 136920037 |
| Molecular Formula | C20H14N2O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-[4-hydroxy-5-[(5-methoxyindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
| SMILES | COc1ccc2c(c1)C(=Cc1sc(=S)n(-c3cccc(C(=O)O)c3)c1O)C=N2 |
| InChI | InChI=1S/C20H14N2O4S2/c1-26-14-5-6-16-15(9-14)12(10-21-16)8-17-18(23)22(20(27)28-17)13-4-2-3-11(7-13)19(24)25/h2-10,23H,1H3,(H,24,25) |
| InChIKey | KBYISYALLCQJSN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|