C14H10N2O2S2 — CID 1327582
3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]-7-methylquinolin-2-one (PubChem CID 1327582) has the molecular formula C14H10N2O2S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]-7-methylquinolin-2-one.
| Compound Name | 3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]-7-methylquinolin-2-one |
|---|---|
| PubChem CID | 1327582 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]-7-methylquinolin-2-one |
| SMILES | Cc1ccc2c(c1)=NC(=O)C(=Cc1sc(=S)[nH]c1O)C=2 |
| InChI | InChI=1S/C14H10N2O2S2/c1-7-2-3-8-5-9(12(17)15-10(8)4-7)6-11-13(18)16-14(19)20-11/h2-6,18H,1H3,(H,16,19) |
| InChIKey | AZAMZSVIILTSEQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|