C18H18N2OS2 — CID 15356871
5-(dimethylamino)-3-(4-methoxyphenyl)-4-phenyl-1,3-thiazole-2-thione (PubChem CID 15356871) has the molecular formula C18H18N2OS2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 5-(dimethylamino)-3-(4-methoxyphenyl)-4-phenyl-1,3-thiazole-2-thione.
| Compound Name | 5-(dimethylamino)-3-(4-methoxyphenyl)-4-phenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 15356871 |
| Molecular Formula | C18H18N2OS2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-(dimethylamino)-3-(4-methoxyphenyl)-4-phenyl-1,3-thiazole-2-thione |
| SMILES | COc1ccc(-n2c(-c3ccccc3)c(N(C)C)sc2=S)cc1 |
| InChI | InChI=1S/C18H18N2OS2/c1-19(2)17-16(13-7-5-4-6-8-13)20(18(22)23-17)14-9-11-15(21-3)12-10-14/h4-12H,1-3H3 |
| InChIKey | FLGSKRUTMLFCCL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|