C15H12N4O2S2 — CID 14490099
5-N-methyl-3-N-(4-nitrophenyl)-4-phenyl-1,2,4-dithiazolidine-3,5-diimine (PubChem CID 14490099) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-N-methyl-3-N-(4-nitrophenyl)-4-phenyl-1,2,4-dithiazolidine-3,5-diimine.
| Compound Name | 5-N-methyl-3-N-(4-nitrophenyl)-4-phenyl-1,2,4-dithiazolidine-3,5-diimine |
|---|---|
| PubChem CID | 14490099 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-N-methyl-3-N-(4-nitrophenyl)-4-phenyl-1,2,4-dithiazolidine-3,5-diimine |
| SMILES | C/N=c1\ss/c(=N\c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H12N4O2S2/c1-16-14-18(12-5-3-2-4-6-12)15(23-22-14)17-11-7-9-13(10-8-11)19(20)21/h2-10H,1H3/b16-14-,17-15- |
| InChIKey | BPBFEJKQERCLCM-RYOQUFEFSA-N |
| XLogP | 3.27 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|