C24H16ClN7O3S — CID 139228131
N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methyl-5-[(4-nitrophenyl)diazenyl]-3-phenyl-1,3-thiazol-2-imine (PubChem CID 139228131) has the molecular formula C24H16ClN7O3S and a molecular weight of 517.96 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methyl-5-[(4-nitrophenyl)diazenyl]-3-phenyl-1,3-thiazol-2-imine.
| Compound Name | N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methyl-5-[(4-nitrophenyl)diazenyl]-3-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 139228131 |
| Molecular Formula | C24H16ClN7O3S |
| Molecular Weight | 517.96 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methyl-5-[(4-nitrophenyl)diazenyl]-3-phenyl-1,3-thiazol-2-imine |
| SMILES | Cc1c(/N=N/c2ccc([N+](=O)[O-])cc2)sc(=Nc2nnc(-c3ccc(Cl)cc3)o2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H16ClN7O3S/c1-15-22(29-27-18-11-13-20(14-12-18)32(33)34)36-24(31(15)19-5-3-2-4-6-19)26-23-30-28-21(35-23)16-7-9-17(25)10-8-16/h2-14H,1H3/b26-24?,29-27+ |
| InChIKey | VCAAUMMQVQCJQQ-QHFBUWGUSA-N |
| XLogP | 7.11 |
| TPSA | 124.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.96 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|