C21H16N4O4S — CID 42598700
N-[3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-ylidene]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 42598700) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-ylidene]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-ylidene]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 42598700 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-ylidene]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cs/c2=N\C(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H16N4O4S/c1-29-15-9-7-14(8-10-15)25-17(13-5-3-2-4-6-13)12-30-21(25)24-19(27)16-11-18(26)23-20(28)22-16/h2-12H,1H3,(H2,22,23,26,28)/b24-21- |
| InChIKey | CTNAHCYMAULOFB-FLFQWRMESA-N |
| XLogP | 2.33 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|