About N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride
N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride (PubChem CID 128962848) has the molecular formula C20H15ClN2O2S
and a molecular weight of 382.87 g/mol. Its IUPAC name is N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride |
| PubChem CID | 128962848 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(/N=c1\scc(-c2ccccc2)n1-c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H14N2O2S.ClH/c23-19(18-12-7-13-24-18)21-20-22(16-10-5-2-6-11-16)17(14-25-20)15-8-3-1-4-9-15;/h1-14H;1H/b21-20-; |
| InChIKey | VVRBIEWXHJONMI-CFRCJOIHSA-N |
| XLogP | 4.96 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride?
The IUPAC name of N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride (CID 128962848) is N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride.
What is the SMILES notation for N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride?
The canonical SMILES for N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride is Cl.O=C(/N=c1\scc(-c2ccccc2)n1-c1ccccc1)c1ccco1.
What is the InChIKey of N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride?
The InChIKey is VVRBIEWXHJONMI-CFRCJOIHSA-N. The full InChI is InChI=1S/C20H14N2O2S.ClH/c23-19(18-12-7-13-24-18)21-20-22(16-10-5-2-6-11-16)17(14-25-20)15-8-3-1-4-9-15;/h1-14H;1H/b21-20-;.
What are the key properties of N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride?
N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride has a molecular weight of 382.87 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-diphenyl-1,3-thiazol-2-ylidene)furan-2-carboxamide;hydrochloride is sourced from PubChem (CID 128962848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).