C14H10N2O3S — CID 1379458
N-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)furan-2-carboxamide (PubChem CID 1379458) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is N-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)furan-2-carboxamide.
| Compound Name | N-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 1379458 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)furan-2-carboxamide |
| SMILES | O=C(/N=C1\SCC(=O)N1c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C14H10N2O3S/c17-12-9-20-14(15-13(18)11-7-4-8-19-11)16(12)10-5-2-1-3-6-10/h1-8H,9H2/b15-14- |
| InChIKey | YKBLNGINJMGMTG-PFONDFGASA-N |
| XLogP | 2.56 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|