C14H11ClN2O2S — CID 557423
2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 557423) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 557423 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-(4-chlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ccc(Cl)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C14H11ClN2O2S/c15-10-3-5-11(6-4-10)16-14-17(13(18)9-20-14)8-12-2-1-7-19-12/h1-7H,8-9H2/b16-14- |
| InChIKey | ZVPBSQJAXFCKGQ-PEZBUJJGSA-N |
| XLogP | 3.70 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|