C22H20N2O3S — CID 44725975
4-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3-thiazol-2-imine (PubChem CID 44725975) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 44725975 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\Cc3ccco3)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H20N2O3S/c1-25-20-11-10-16(13-21(20)26-2)19-15-28-22(23-14-18-9-6-12-27-18)24(19)17-7-4-3-5-8-17/h3-13,15H,14H2,1-2H3/b23-22- |
| InChIKey | NTXUFEHBAVARNB-FCQUAONHSA-N |
| XLogP | 4.92 |
| TPSA | 48.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|