C17H14ClNO5 — CID 110583680
3-chloro-4-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110583680) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583680 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Cl)C(=O)N(Cc3ccco3)C2=O)cc1OC |
| InChI | InChI=1S/C17H14ClNO5/c1-22-12-6-5-10(8-13(12)23-2)14-15(18)17(21)19(16(14)20)9-11-4-3-7-24-11/h3-8H,9H2,1-2H3 |
| InChIKey | QSMGLMGCJAEFQH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|