C17H20ClNO4 — CID 110583685
3-chloro-4-(3,4-dimethoxyphenyl)-1-pentylpyrrole-2,5-dione (PubChem CID 110583685) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583685 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(Cl)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C17H20ClNO4/c1-4-5-6-9-19-16(20)14(15(18)17(19)21)11-7-8-12(22-2)13(10-11)23-3/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | ULNFJVFRVXSQCA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|