C20H26ClNO4 — CID 110583712
3-chloro-4-(3,4-dimethoxyphenyl)-1-octylpyrrole-2,5-dione (PubChem CID 110583712) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-octylpyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-octylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583712 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-octylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(Cl)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H26ClNO4/c1-4-5-6-7-8-9-12-22-19(23)17(18(21)20(22)24)14-10-11-15(25-2)16(13-14)26-3/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | AFMNTMOIOXBOGD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|