C21H20ClNO6 — CID 110583714
3-chloro-4-(3,4-dimethoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione (PubChem CID 110583714) has the molecular formula C21H20ClNO6 and a molecular weight of 417.85 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583714 |
| Molecular Formula | C21H20ClNO6 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C(Cl)=C(c3ccc(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H20ClNO6/c1-26-14-7-5-12(9-16(14)28-3)11-23-20(24)18(19(22)21(23)25)13-6-8-15(27-2)17(10-13)29-4/h5-10H,11H2,1-4H3 |
| InChIKey | SCZUCCUJOHQJRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|